C13H18N2O5 — CID 115413154
2-[(2-amino-4-methoxybenzoyl)amino]-4-methoxybutanoic acid (PubChem CID 115413154) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[(2-amino-4-methoxybenzoyl)amino]-4-methoxybutanoic acid.
| Compound Name | 2-[(2-amino-4-methoxybenzoyl)amino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 115413154 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-[(2-amino-4-methoxybenzoyl)amino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)c1ccc(OC)cc1N)C(=O)O |
| InChI | InChI=1S/C13H18N2O5/c1-19-6-5-11(13(17)18)15-12(16)9-4-3-8(20-2)7-10(9)14/h3-4,7,11H,5-6,14H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | MHLIXYHAIQGAMX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|