C20H18FN7O2 — CID 56568506
N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-4-[(1-methylimidazol-2-yl)methoxy]benzamide (PubChem CID 56568506) has the molecular formula C20H18FN7O2 and a molecular weight of 407.41 g/mol. Its IUPAC name is N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-4-[(1-methylimidazol-2-yl)methoxy]benzamide.
| Compound Name | N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-4-[(1-methylimidazol-2-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 56568506 |
| Molecular Formula | C20H18FN7O2 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-4-[(1-methylimidazol-2-yl)methoxy]benzamide |
| SMILES | Cc1nnnn1-c1ccc(F)c(NC(=O)c2ccc(OCc3nccn3C)cc2)c1 |
| InChI | InChI=1S/C20H18FN7O2/c1-13-24-25-26-28(13)15-5-8-17(21)18(11-15)23-20(29)14-3-6-16(7-4-14)30-12-19-22-9-10-27(19)2/h3-11H,12H2,1-2H3,(H,23,29) |
| InChIKey | LXTVDFJPRUGGKD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |