C15H20FN5OS — CID 95616798
(2S)-2-ethylsulfanyl-N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-3-methylbutanamide (PubChem CID 95616798) has the molecular formula C15H20FN5OS and a molecular weight of 337.42 g/mol. Its IUPAC name is (2S)-2-ethylsulfanyl-N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-3-methylbutanamide.
| Compound Name | (2S)-2-ethylsulfanyl-N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 95616798 |
| Molecular Formula | C15H20FN5OS |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (2S)-2-ethylsulfanyl-N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-3-methylbutanamide |
| SMILES | CCS[C@H](C(=O)Nc1cc(-n2nnnc2C)ccc1F)C(C)C |
| InChI | InChI=1S/C15H20FN5OS/c1-5-23-14(9(2)3)15(22)17-13-8-11(6-7-12(13)16)21-10(4)18-19-20-21/h6-9,14H,5H2,1-4H3,(H,17,22)/t14-/m0/s1 |
| InChIKey | VURYGDMLMGVRSH-AWEZNQCLSA-N |
| XLogP | 2.83 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |