C20H19ClFN5O2 — CID 56568346
4-(4-chlorophenyl)-N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]oxane-4-carboxamide (PubChem CID 56568346) has the molecular formula C20H19ClFN5O2 and a molecular weight of 415.86 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]oxane-4-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 56568346 |
| Molecular Formula | C20H19ClFN5O2 |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]oxane-4-carboxamide |
| SMILES | Cc1nnnn1-c1ccc(F)c(NC(=O)C2(c3ccc(Cl)cc3)CCOCC2)c1 |
| InChI | InChI=1S/C20H19ClFN5O2/c1-13-24-25-26-27(13)16-6-7-17(22)18(12-16)23-19(28)20(8-10-29-11-9-20)14-2-4-15(21)5-3-14/h2-7,12H,8-11H2,1H3,(H,23,28) |
| InChIKey | OUUBJKHMEKRTDA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |