C17H14ClF2NO — CID 134022500
N-(5-chloro-2-fluorophenyl)-1-(4-fluorophenyl)cyclobutane-1-carboxamide (PubChem CID 134022500) has the molecular formula C17H14ClF2NO and a molecular weight of 321.75 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-1-(4-fluorophenyl)cyclobutane-1-carboxamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-1-(4-fluorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 134022500 |
| Molecular Formula | C17H14ClF2NO |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-1-(4-fluorophenyl)cyclobutane-1-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1F)C1(c2ccc(F)cc2)CCC1 |
| InChI | InChI=1S/C17H14ClF2NO/c18-12-4-7-14(20)15(10-12)21-16(22)17(8-1-9-17)11-2-5-13(19)6-3-11/h2-7,10H,1,8-9H2,(H,21,22) |
| InChIKey | JJFMHAKTKMGIRO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |