C16H12ClF2NO — CID 134002638
N-(4-chloro-2-fluorophenyl)-1-(4-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 134002638) has the molecular formula C16H12ClF2NO and a molecular weight of 307.73 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-1-(4-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-1-(4-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134002638 |
| Molecular Formula | C16H12ClF2NO |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-1-(4-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)C1(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H12ClF2NO/c17-11-3-6-14(13(19)9-11)20-15(21)16(7-8-16)10-1-4-12(18)5-2-10/h1-6,9H,7-8H2,(H,20,21) |
| InChIKey | ZAVOOGHDMVKOCJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |