C16H14FNO2 — CID 64786881
N-(2-fluoro-4-hydroxyphenyl)-1-phenylcyclopropane-1-carboxamide (PubChem CID 64786881) has the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. Its IUPAC name is N-(2-fluoro-4-hydroxyphenyl)-1-phenylcyclopropane-1-carboxamide.
| Compound Name | N-(2-fluoro-4-hydroxyphenyl)-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 64786881 |
| Molecular Formula | C16H14FNO2 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(2-fluoro-4-hydroxyphenyl)-1-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1F)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H14FNO2/c17-13-10-12(19)6-7-14(13)18-15(20)16(8-9-16)11-4-2-1-3-5-11/h1-7,10,19H,8-9H2,(H,18,20) |
| InChIKey | OCJAJDPHDHIADD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|