C17H15F2NO — CID 110438554
N-(2,6-difluorophenyl)-1-phenylcyclobutane-1-carboxamide (PubChem CID 110438554) has the molecular formula C17H15F2NO and a molecular weight of 287.31 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-1-phenylcyclobutane-1-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-1-phenylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 110438554 |
| Molecular Formula | C17H15F2NO |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-1-phenylcyclobutane-1-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)C1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C17H15F2NO/c18-13-8-4-9-14(19)15(13)20-16(21)17(10-5-11-17)12-6-2-1-3-7-12/h1-4,6-9H,5,10-11H2,(H,20,21) |
| InChIKey | VUWBZGMFJDOZNG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |