C16H11ClF3NO — CID 26357521
1-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide (PubChem CID 26357521) has the molecular formula C16H11ClF3NO and a molecular weight of 325.72 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 26357521 |
| Molecular Formula | C16H11ClF3NO |
| Molecular Weight | 325.72 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H11ClF3NO/c17-10-3-1-9(2-4-10)16(7-8-16)15(22)21-12-6-5-11(18)13(19)14(12)20/h1-6H,7-8H2,(H,21,22) |
| InChIKey | WAIOESJLAIGUMD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|