C17H15BrClNO — CID 112790088
N-(4-bromo-2-methylphenyl)-1-(4-chlorophenyl)cyclopropane-1-carboxamide (PubChem CID 112790088) has the molecular formula C17H15BrClNO and a molecular weight of 364.67 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-1-(4-chlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-1-(4-chlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 112790088 |
| Molecular Formula | C17H15BrClNO |
| Molecular Weight | 364.67 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-1-(4-chlorophenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H15BrClNO/c1-11-10-13(18)4-7-15(11)20-16(21)17(8-9-17)12-2-5-14(19)6-3-12/h2-7,10H,8-9H2,1H3,(H,20,21) |
| InChIKey | MFTGZPIKQCFWFV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |