C21H22BrFN2O2 — CID 112761225
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-1-(4-fluorophenyl)cyclopentane-1-carboxamide (PubChem CID 112761225) has the molecular formula C21H22BrFN2O2 and a molecular weight of 433.32 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-1-(4-fluorophenyl)cyclopentane-1-carboxamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-1-(4-fluorophenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 112761225 |
| Molecular Formula | C21H22BrFN2O2 |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-1-(4-fluorophenyl)cyclopentane-1-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)C1(c2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C21H22BrFN2O2/c1-14-12-16(22)6-9-18(14)25-19(26)13-24-20(27)21(10-2-3-11-21)15-4-7-17(23)8-5-15/h4-9,12H,2-3,10-11,13H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | ZPKDSJHVHINRIB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |