C20H20BrFN2O2 — CID 32983634
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide (PubChem CID 32983634) has the molecular formula C20H20BrFN2O2 and a molecular weight of 419.29 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 32983634 |
| Molecular Formula | C20H20BrFN2O2 |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)C1(c2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C20H20BrFN2O2/c1-13-10-15(21)6-7-17(13)24-18(25)12-23-19(26)20(8-3-9-20)14-4-2-5-16(22)11-14/h2,4-7,10-11H,3,8-9,12H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | JLFSTDOAAXFHSZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |