C18H24FNO2 — CID 111445692
1-(3-fluorophenyl)-N-[(1-hydroxycyclobutyl)methyl]cyclohexane-1-carboxamide (PubChem CID 111445692) has the molecular formula C18H24FNO2 and a molecular weight of 305.39 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[(1-hydroxycyclobutyl)methyl]cyclohexane-1-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-[(1-hydroxycyclobutyl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 111445692 |
| Molecular Formula | C18H24FNO2 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[(1-hydroxycyclobutyl)methyl]cyclohexane-1-carboxamide |
| SMILES | O=C(NCC1(O)CCC1)C1(c2cccc(F)c2)CCCCC1 |
| InChI | InChI=1S/C18H24FNO2/c19-15-7-4-6-14(12-15)18(10-2-1-3-11-18)16(21)20-13-17(22)8-5-9-17/h4,6-7,12,22H,1-3,5,8-11,13H2,(H,20,21) |
| InChIKey | IAYWAUYCRJJVCB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |