C21H21F2NO — CID 55748767
1-(3-fluorophenyl)-N-[[1-(4-fluorophenyl)cyclopropyl]methyl]cyclobutane-1-carboxamide (PubChem CID 55748767) has the molecular formula C21H21F2NO and a molecular weight of 341.40 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[[1-(4-fluorophenyl)cyclopropyl]methyl]cyclobutane-1-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-[[1-(4-fluorophenyl)cyclopropyl]methyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 55748767 |
| Molecular Formula | C21H21F2NO |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[[1-(4-fluorophenyl)cyclopropyl]methyl]cyclobutane-1-carboxamide |
| SMILES | O=C(NCC1(c2ccc(F)cc2)CC1)C1(c2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C21H21F2NO/c22-17-7-5-15(6-8-17)20(11-12-20)14-24-19(25)21(9-2-10-21)16-3-1-4-18(23)13-16/h1,3-8,13H,2,9-12,14H2,(H,24,25) |
| InChIKey | CJXNBMBCQOQEFR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |