C18H16BrF2NO — CID 55900607
N-[(2-bromo-5-fluorophenyl)methyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide (PubChem CID 55900607) has the molecular formula C18H16BrF2NO and a molecular weight of 380.23 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 55900607 |
| Molecular Formula | C18H16BrF2NO |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide |
| SMILES | O=C(NCc1cc(F)ccc1Br)C1(c2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C18H16BrF2NO/c19-16-6-5-15(21)9-12(16)11-22-17(23)18(7-2-8-18)13-3-1-4-14(20)10-13/h1,3-6,9-10H,2,7-8,11H2,(H,22,23) |
| InChIKey | HWDOJJQOQHDSBS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |