C22H23ClFNO2 — CID 46977992
N-[[1-(2-chlorophenyl)cyclopropyl]methyl]-4-(3-fluorophenyl)oxane-4-carboxamide (PubChem CID 46977992) has the molecular formula C22H23ClFNO2 and a molecular weight of 387.88 g/mol. Its IUPAC name is N-[[1-(2-chlorophenyl)cyclopropyl]methyl]-4-(3-fluorophenyl)oxane-4-carboxamide.
| Compound Name | N-[[1-(2-chlorophenyl)cyclopropyl]methyl]-4-(3-fluorophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 46977992 |
| Molecular Formula | C22H23ClFNO2 |
| Molecular Weight | 387.88 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-[[1-(2-chlorophenyl)cyclopropyl]methyl]-4-(3-fluorophenyl)oxane-4-carboxamide |
| SMILES | O=C(NCC1(c2ccccc2Cl)CC1)C1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C22H23ClFNO2/c23-19-7-2-1-6-18(19)21(8-9-21)15-25-20(26)22(10-12-27-13-11-22)16-4-3-5-17(24)14-16/h1-7,14H,8-13,15H2,(H,25,26) |
| InChIKey | JKBQMISXMPGAQC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |