C19H24ClNO5 — CID 120542025
4-[[[4-(2-chlorophenyl)oxane-4-carbonyl]amino]methyl]oxane-4-carboxylic acid (PubChem CID 120542025) has the molecular formula C19H24ClNO5 and a molecular weight of 381.86 g/mol. Its IUPAC name is 4-[[[4-(2-chlorophenyl)oxane-4-carbonyl]amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[[4-(2-chlorophenyl)oxane-4-carbonyl]amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120542025 |
| Molecular Formula | C19H24ClNO5 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 4-[[[4-(2-chlorophenyl)oxane-4-carbonyl]amino]methyl]oxane-4-carboxylic acid |
| SMILES | O=C(O)C1(CNC(=O)C2(c3ccccc3Cl)CCOCC2)CCOCC1 |
| InChI | InChI=1S/C19H24ClNO5/c20-15-4-2-1-3-14(15)19(7-11-26-12-8-19)16(22)21-13-18(17(23)24)5-9-25-10-6-18/h1-4H,5-13H2,(H,21,22)(H,23,24) |
| InChIKey | CJMYPWNEAFGOEY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |