C20H27NO4 — CID 120544882
1-[[(4-phenyloxane-4-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 120544882) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-[[(4-phenyloxane-4-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[(4-phenyloxane-4-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120544882 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-[[(4-phenyloxane-4-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(CNC(=O)C2(c3ccccc3)CCOCC2)CCCCC1 |
| InChI | InChI=1S/C20H27NO4/c22-17(21-15-19(18(23)24)9-5-2-6-10-19)20(11-13-25-14-12-20)16-7-3-1-4-8-16/h1,3-4,7-8H,2,5-6,9-15H2,(H,21,22)(H,23,24) |
| InChIKey | AEUSGQDTEKIPOG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |