C24H31NO3S — CID 121179056
N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]-4-phenyloxane-4-carboxamide (PubChem CID 121179056) has the molecular formula C24H31NO3S and a molecular weight of 413.58 g/mol. Its IUPAC name is N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]-4-phenyloxane-4-carboxamide.
| Compound Name | N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]-4-phenyloxane-4-carboxamide |
|---|---|
| PubChem CID | 121179056 |
| Molecular Formula | C24H31NO3S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]-4-phenyloxane-4-carboxamide |
| SMILES | CC(O)c1ccc(C2(CNC(=O)C3(c4ccccc4)CCOCC3)CCCC2)s1 |
| InChI | InChI=1S/C24H31NO3S/c1-18(26)20-9-10-21(29-20)23(11-5-6-12-23)17-25-22(27)24(13-15-28-16-14-24)19-7-3-2-4-8-19/h2-4,7-10,18,26H,5-6,11-17H2,1H3,(H,25,27) |
| InChIKey | FNUHTFZZNCFWNR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |