C16H20ClNO4S — CID 119242729
2-[2-[[4-(2-chlorophenyl)oxane-4-carbonyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119242729) has the molecular formula C16H20ClNO4S and a molecular weight of 357.86 g/mol. Its IUPAC name is 2-[2-[[4-(2-chlorophenyl)oxane-4-carbonyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[4-(2-chlorophenyl)oxane-4-carbonyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119242729 |
| Molecular Formula | C16H20ClNO4S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[2-[[4-(2-chlorophenyl)oxane-4-carbonyl]amino]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)C1(c2ccccc2Cl)CCOCC1 |
| InChI | InChI=1S/C16H20ClNO4S/c17-13-4-2-1-3-12(13)16(5-8-22-9-6-16)15(21)18-7-10-23-11-14(19)20/h1-4H,5-11H2,(H,18,21)(H,19,20) |
| InChIKey | HINPXBZALPMGPK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|