C19H24ClNO4 — CID 119178898
2-[1-[4-(2-chlorophenyl)oxane-4-carbonyl]piperidin-4-yl]acetic acid (PubChem CID 119178898) has the molecular formula C19H24ClNO4 and a molecular weight of 365.86 g/mol. Its IUPAC name is 2-[1-[4-(2-chlorophenyl)oxane-4-carbonyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[4-(2-chlorophenyl)oxane-4-carbonyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 119178898 |
| Molecular Formula | C19H24ClNO4 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[1-[4-(2-chlorophenyl)oxane-4-carbonyl]piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(C(=O)C2(c3ccccc3Cl)CCOCC2)CC1 |
| InChI | InChI=1S/C19H24ClNO4/c20-16-4-2-1-3-15(16)19(7-11-25-12-8-19)18(24)21-9-5-14(6-10-21)13-17(22)23/h1-4,14H,5-13H2,(H,22,23) |
| InChIKey | KRFLUCUOSQSMIL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |