C20H22FNO3 — CID 110001666
4-(3-fluorophenyl)-N-[(1S)-2-hydroxy-1-phenylethyl]oxane-4-carboxamide (PubChem CID 110001666) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-[(1S)-2-hydroxy-1-phenylethyl]oxane-4-carboxamide.
| Compound Name | 4-(3-fluorophenyl)-N-[(1S)-2-hydroxy-1-phenylethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 110001666 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 4-(3-fluorophenyl)-N-[(1S)-2-hydroxy-1-phenylethyl]oxane-4-carboxamide |
| SMILES | O=C(N[C@H](CO)c1ccccc1)C1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C20H22FNO3/c21-17-8-4-7-16(13-17)20(9-11-25-12-10-20)19(24)22-18(14-23)15-5-2-1-3-6-15/h1-8,13,18,23H,9-12,14H2,(H,22,24)/t18-/m1/s1 |
| InChIKey | WWXMGCULURKVLU-GOSISDBHSA-N |
| XLogP | 2.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |