C18H18FN3O4 — CID 71886339
4-(3-fluorophenyl)-N'-(2-nitrophenyl)oxane-4-carbohydrazide (PubChem CID 71886339) has the molecular formula C18H18FN3O4 and a molecular weight of 359.36 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N'-(2-nitrophenyl)oxane-4-carbohydrazide.
| Compound Name | 4-(3-fluorophenyl)-N'-(2-nitrophenyl)oxane-4-carbohydrazide |
|---|---|
| PubChem CID | 71886339 |
| Molecular Formula | C18H18FN3O4 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-(3-fluorophenyl)-N'-(2-nitrophenyl)oxane-4-carbohydrazide |
| SMILES | O=C(NNc1ccccc1[N+](=O)[O-])C1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C18H18FN3O4/c19-14-5-3-4-13(12-14)18(8-10-26-11-9-18)17(23)21-20-15-6-1-2-7-16(15)22(24)25/h1-7,12,20H,8-11H2,(H,21,23) |
| InChIKey | WGCKVVSGXOHHRM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|