C18H27FN2O — CID 120651377
N-[(2R)-2-(ethylamino)propyl]-1-(3-fluorophenyl)cyclohexane-1-carboxamide (PubChem CID 120651377) has the molecular formula C18H27FN2O and a molecular weight of 306.43 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-1-(3-fluorophenyl)cyclohexane-1-carboxamide.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-1-(3-fluorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 120651377 |
| Molecular Formula | C18H27FN2O |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-1-(3-fluorophenyl)cyclohexane-1-carboxamide |
| SMILES | CCN[C@H](C)CNC(=O)C1(c2cccc(F)c2)CCCCC1 |
| InChI | InChI=1S/C18H27FN2O/c1-3-20-14(2)13-21-17(22)18(10-5-4-6-11-18)15-8-7-9-16(19)12-15/h7-9,12,14,20H,3-6,10-11,13H2,1-2H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | FWQQNCYIZRUDGE-CQSZACIVSA-N |
| XLogP | 3.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |