C18H26FNO3 — CID 111791814
1-(3-fluorophenyl)-N-[2-hydroxy-3-(2-methylpropoxy)propyl]cyclobutane-1-carboxamide (PubChem CID 111791814) has the molecular formula C18H26FNO3 and a molecular weight of 323.41 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[2-hydroxy-3-(2-methylpropoxy)propyl]cyclobutane-1-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-[2-hydroxy-3-(2-methylpropoxy)propyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 111791814 |
| Molecular Formula | C18H26FNO3 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[2-hydroxy-3-(2-methylpropoxy)propyl]cyclobutane-1-carboxamide |
| SMILES | CC(C)COCC(O)CNC(=O)C1(c2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C18H26FNO3/c1-13(2)11-23-12-16(21)10-20-17(22)18(7-4-8-18)14-5-3-6-15(19)9-14/h3,5-6,9,13,16,21H,4,7-8,10-12H2,1-2H3,(H,20,22) |
| InChIKey | XJVLMFGFGVZYQM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |