C15H19FN2O3 — CID 75381149
N-[2-(2-amino-2-oxoethoxy)ethyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide (PubChem CID 75381149) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethoxy)ethyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide.
| Compound Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 75381149 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide |
| SMILES | NC(=O)COCCNC(=O)C1(c2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C15H19FN2O3/c16-12-4-1-3-11(9-12)15(5-2-6-15)14(20)18-7-8-21-10-13(17)19/h1,3-4,9H,2,5-8,10H2,(H2,17,19)(H,18,20) |
| InChIKey | UNBWZIUQCQAUND-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|