C17H24FNO2S — CID 95623396
N-[2-[(S)-tert-butylsulfinyl]ethyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide (PubChem CID 95623396) has the molecular formula C17H24FNO2S and a molecular weight of 325.45 g/mol. Its IUPAC name is N-[2-[(S)-tert-butylsulfinyl]ethyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide.
| Compound Name | N-[2-[(S)-tert-butylsulfinyl]ethyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 95623396 |
| Molecular Formula | C17H24FNO2S |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[2-[(S)-tert-butylsulfinyl]ethyl]-1-(3-fluorophenyl)cyclobutane-1-carboxamide |
| SMILES | CC(C)(C)[S@@](=O)CCNC(=O)C1(c2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C17H24FNO2S/c1-16(2,3)22(21)11-10-19-15(20)17(8-5-9-17)13-6-4-7-14(18)12-13/h4,6-7,12H,5,8-11H2,1-3H3,(H,19,20)/t22-/m0/s1 |
| InChIKey | LLIZCROGAVGUAI-QFIPXVFZSA-N |
| XLogP | 2.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |