C13H15FN2O2 — CID 110473843
N-(2-amino-2-oxoethyl)-1-(4-fluorophenyl)cyclobutane-1-carboxamide (PubChem CID 110473843) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-1-(4-fluorophenyl)cyclobutane-1-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-1-(4-fluorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 110473843 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-1-(4-fluorophenyl)cyclobutane-1-carboxamide |
| SMILES | NC(=O)CNC(=O)C1(c2ccc(F)cc2)CCC1 |
| InChI | InChI=1S/C13H15FN2O2/c14-10-4-2-9(3-5-10)13(6-1-7-13)12(18)16-8-11(15)17/h2-5H,1,6-8H2,(H2,15,17)(H,16,18) |
| InChIKey | BOICFDOFCPBJNE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |