C20H20FN3O3 — CID 60516608
N-(2-amino-2-oxoethyl)-4-[[[1-(4-fluorophenyl)cyclopropanecarbonyl]amino]methyl]benzamide (PubChem CID 60516608) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[1-(4-fluorophenyl)cyclopropanecarbonyl]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[1-(4-fluorophenyl)cyclopropanecarbonyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 60516608 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[1-(4-fluorophenyl)cyclopropanecarbonyl]amino]methyl]benzamide |
| SMILES | NC(=O)CNC(=O)c1ccc(CNC(=O)C2(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H20FN3O3/c21-16-7-5-15(6-8-16)20(9-10-20)19(27)24-11-13-1-3-14(4-2-13)18(26)23-12-17(22)25/h1-8H,9-12H2,(H2,22,25)(H,23,26)(H,24,27) |
| InChIKey | OTQPXCZORVSYSQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |