C20H20FNO4 — CID 119128001
4-[[[4-(4-fluorophenyl)oxane-4-carbonyl]amino]methyl]benzoic acid (PubChem CID 119128001) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is 4-[[[4-(4-fluorophenyl)oxane-4-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[4-(4-fluorophenyl)oxane-4-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 119128001 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 4-[[[4-(4-fluorophenyl)oxane-4-carbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)C2(c3ccc(F)cc3)CCOCC2)cc1 |
| InChI | InChI=1S/C20H20FNO4/c21-17-7-5-16(6-8-17)20(9-11-26-12-10-20)19(25)22-13-14-1-3-15(4-2-14)18(23)24/h1-8H,9-13H2,(H,22,25)(H,23,24) |
| InChIKey | OAMSPBNVMUPQNR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |