C21H23NO3 — CID 134561755
4-[[(1-phenylcyclohexanecarbonyl)amino]methyl]benzoic acid (PubChem CID 134561755) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 4-[[(1-phenylcyclohexanecarbonyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(1-phenylcyclohexanecarbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 134561755 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 4-[[(1-phenylcyclohexanecarbonyl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)C2(c3ccccc3)CCCCC2)cc1 |
| InChI | InChI=1S/C21H23NO3/c23-19(24)17-11-9-16(10-12-17)15-22-20(25)21(13-5-2-6-14-21)18-7-3-1-4-8-18/h1,3-4,7-12H,2,5-6,13-15H2,(H,22,25)(H,23,24) |
| InChIKey | NONVFXRPYSQNFA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |