C22H26N2O2 — CID 34833770
N,N-diethyl-4-[[(1-phenylcyclopropanecarbonyl)amino]methyl]benzamide (PubChem CID 34833770) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is N,N-diethyl-4-[[(1-phenylcyclopropanecarbonyl)amino]methyl]benzamide.
| Compound Name | N,N-diethyl-4-[[(1-phenylcyclopropanecarbonyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 34833770 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N,N-diethyl-4-[[(1-phenylcyclopropanecarbonyl)amino]methyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(CNC(=O)C2(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-3-24(4-2)20(25)18-12-10-17(11-13-18)16-23-21(26)22(14-15-22)19-8-6-5-7-9-19/h5-13H,3-4,14-16H2,1-2H3,(H,23,26) |
| InChIKey | TUGIGVQOUVJKSF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |