C25H34N4O — CID 111855460
N,N-diethyl-4-[[[N'-methyl-N-[(1-phenylcyclobutyl)methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111855460) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is N,N-diethyl-4-[[[N'-methyl-N-[(1-phenylcyclobutyl)methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N,N-diethyl-4-[[[N'-methyl-N-[(1-phenylcyclobutyl)methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111855460 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | N,N-diethyl-4-[[[N'-methyl-N-[(1-phenylcyclobutyl)methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(CN/C(=N/C)NCC2(c3ccccc3)CCC2)cc1 |
| InChI | InChI=1S/C25H34N4O/c1-4-29(5-2)23(30)21-14-12-20(13-15-21)18-27-24(26-3)28-19-25(16-9-17-25)22-10-7-6-8-11-22/h6-8,10-15H,4-5,9,16-19H2,1-3H3,(H2,26,27,28) |
| InChIKey | UUPYVUJFANMPCU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|