C24H32N4O — CID 111852452
N-ethyl-4-[[[N'-methyl-N-[(1-phenylcyclopentyl)methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111852452) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is N-ethyl-4-[[[N'-methyl-N-[(1-phenylcyclopentyl)methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-ethyl-4-[[[N'-methyl-N-[(1-phenylcyclopentyl)methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111852452 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | N-ethyl-4-[[[N'-methyl-N-[(1-phenylcyclopentyl)methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | CCNC(=O)c1ccc(CN/C(=N/C)NCC2(c3ccccc3)CCCC2)cc1 |
| InChI | InChI=1S/C24H32N4O/c1-3-26-22(29)20-13-11-19(12-14-20)17-27-23(25-2)28-18-24(15-7-8-16-24)21-9-5-4-6-10-21/h4-6,9-14H,3,7-8,15-18H2,1-2H3,(H,26,29)(H2,25,27,28) |
| InChIKey | SVIYEQZUGPQEBI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|