C22H28N4O — CID 111856962
N-ethyl-3-[[[N'-methyl-N-[(1-phenylcyclopropyl)methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111856962) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is N-ethyl-3-[[[N'-methyl-N-[(1-phenylcyclopropyl)methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-ethyl-3-[[[N'-methyl-N-[(1-phenylcyclopropyl)methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111856962 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N-ethyl-3-[[[N'-methyl-N-[(1-phenylcyclopropyl)methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | CCNC(=O)c1cccc(CN/C(=N/C)NCC2(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H28N4O/c1-3-24-20(27)18-9-7-8-17(14-18)15-25-21(23-2)26-16-22(12-13-22)19-10-5-4-6-11-19/h4-11,14H,3,12-13,15-16H2,1-2H3,(H,24,27)(H2,23,25,26) |
| InChIKey | HSEGXUATBPTEQC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|