C22H29IN4O — CID 111856143
N-[3-[[N'-methyl-N-[(1-phenylcyclopropyl)methyl]carbamimidoyl]amino]propyl]benzamide;hydroiodide (PubChem CID 111856143) has the molecular formula C22H29IN4O and a molecular weight of 492.41 g/mol. Its IUPAC name is N-[3-[[N'-methyl-N-[(1-phenylcyclopropyl)methyl]carbamimidoyl]amino]propyl]benzamide;hydroiodide.
| Compound Name | N-[3-[[N'-methyl-N-[(1-phenylcyclopropyl)methyl]carbamimidoyl]amino]propyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111856143 |
| Molecular Formula | C22H29IN4O |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | N-[3-[[N'-methyl-N-[(1-phenylcyclopropyl)methyl]carbamimidoyl]amino]propyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)c1ccccc1)NCC1(c2ccccc2)CC1.I |
| InChI | InChI=1S/C22H28N4O.HI/c1-23-21(26-17-22(13-14-22)19-11-6-3-7-12-19)25-16-8-15-24-20(27)18-9-4-2-5-10-18;/h2-7,9-12H,8,13-17H2,1H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | UJLVMUSHXPPVRF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|