C21H25BrN4O — CID 111572573
N-[2-[[N-[[1-(3-bromophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide (PubChem CID 111572573) has the molecular formula C21H25BrN4O and a molecular weight of 429.36 g/mol. Its IUPAC name is N-[2-[[N-[[1-(3-bromophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[N-[[1-(3-bromophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111572573 |
| Molecular Formula | C21H25BrN4O |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-[2-[[N-[[1-(3-bromophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccccc1)NCC1(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C21H25BrN4O/c1-23-20(25-13-12-24-19(27)16-6-3-2-4-7-16)26-15-21(10-11-21)17-8-5-9-18(22)14-17/h2-9,14H,10-13,15H2,1H3,(H,24,27)(H2,23,25,26) |
| InChIKey | BBAFSTTWXCPVNX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|