C18H29BrIN3O2S — CID 111522115
1-[[1-(3-bromophenyl)cyclohexyl]methyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111522115) has the molecular formula C18H29BrIN3O2S and a molecular weight of 558.32 g/mol. Its IUPAC name is 1-[[1-(3-bromophenyl)cyclohexyl]methyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-[[1-(3-bromophenyl)cyclohexyl]methyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111522115 |
| Molecular Formula | C18H29BrIN3O2S |
| Molecular Weight | 558.32 g/mol |
| Exact Mass | 557.02 |
| IUPAC Name | 1-[[1-(3-bromophenyl)cyclohexyl]methyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(C)(=O)=O)NCC1(c2cccc(Br)c2)CCCCC1.I |
| InChI | InChI=1S/C18H28BrN3O2S.HI/c1-20-17(21-11-12-25(2,23)24)22-14-18(9-4-3-5-10-18)15-7-6-8-16(19)13-15;/h6-8,13H,3-5,9-12,14H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | QTVPRWMOVZQOIO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|