C22H27FN4O — CID 111638338
N-ethyl-3-[[[N-[[1-(3-fluorophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide (PubChem CID 111638338) has the molecular formula C22H27FN4O and a molecular weight of 382.48 g/mol. Its IUPAC name is N-ethyl-3-[[[N-[[1-(3-fluorophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-ethyl-3-[[[N-[[1-(3-fluorophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111638338 |
| Molecular Formula | C22H27FN4O |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | N-ethyl-3-[[[N-[[1-(3-fluorophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
| SMILES | CCNC(=O)c1cccc(CN/C(=N\C)NCC2(c3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C22H27FN4O/c1-3-25-20(28)17-7-4-6-16(12-17)14-26-21(24-2)27-15-22(10-11-22)18-8-5-9-19(23)13-18/h4-9,12-13H,3,10-11,14-15H2,1-2H3,(H,25,28)(H2,24,26,27) |
| InChIKey | NDRHZRVHVAJLFK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|