C17H25FN4O — CID 111638688
N-ethyl-2-[[ethylamino-[[1-(3-fluorophenyl)cyclopropyl]methylamino]methylidene]amino]acetamide (PubChem CID 111638688) has the molecular formula C17H25FN4O and a molecular weight of 320.41 g/mol. Its IUPAC name is N-ethyl-2-[[ethylamino-[[1-(3-fluorophenyl)cyclopropyl]methylamino]methylidene]amino]acetamide.
| Compound Name | N-ethyl-2-[[ethylamino-[[1-(3-fluorophenyl)cyclopropyl]methylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111638688 |
| Molecular Formula | C17H25FN4O |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | N-ethyl-2-[[ethylamino-[[1-(3-fluorophenyl)cyclopropyl]methylamino]methylidene]amino]acetamide |
| SMILES | CCNC(=O)C/N=C(\NCC)NCC1(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H25FN4O/c1-3-19-15(23)11-21-16(20-4-2)22-12-17(8-9-17)13-6-5-7-14(18)10-13/h5-7,10H,3-4,8-9,11-12H2,1-2H3,(H,19,23)(H2,20,21,22) |
| InChIKey | NQYNOYOZPGXHIK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|