C17H26FIN4O — CID 111638687
N-ethyl-2-[[ethylamino-[[1-(3-fluorophenyl)cyclopropyl]methylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 111638687) has the molecular formula C17H26FIN4O and a molecular weight of 448.32 g/mol. Its IUPAC name is N-ethyl-2-[[ethylamino-[[1-(3-fluorophenyl)cyclopropyl]methylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-ethyl-2-[[ethylamino-[[1-(3-fluorophenyl)cyclopropyl]methylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111638687 |
| Molecular Formula | C17H26FIN4O |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-ethyl-2-[[ethylamino-[[1-(3-fluorophenyl)cyclopropyl]methylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCNC(=O)C/N=C(\NCC)NCC1(c2cccc(F)c2)CC1.I |
| InChI | InChI=1S/C17H25FN4O.HI/c1-3-19-15(23)11-21-16(20-4-2)22-12-17(8-9-17)13-6-5-7-14(18)10-13;/h5-7,10H,3-4,8-9,11-12H2,1-2H3,(H,19,23)(H2,20,21,22);1H |
| InChIKey | KASUVFDUVIRKNP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|