C21H31FN4O — CID 111638506
N-cyclohexyl-2-[[ethylamino-[[1-(3-fluorophenyl)cyclopropyl]methylamino]methylidene]amino]acetamide (PubChem CID 111638506) has the molecular formula C21H31FN4O and a molecular weight of 374.50 g/mol. Its IUPAC name is N-cyclohexyl-2-[[ethylamino-[[1-(3-fluorophenyl)cyclopropyl]methylamino]methylidene]amino]acetamide.
| Compound Name | N-cyclohexyl-2-[[ethylamino-[[1-(3-fluorophenyl)cyclopropyl]methylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111638506 |
| Molecular Formula | C21H31FN4O |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | N-cyclohexyl-2-[[ethylamino-[[1-(3-fluorophenyl)cyclopropyl]methylamino]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC1CCCCC1)NCC1(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H31FN4O/c1-2-23-20(24-14-19(27)26-18-9-4-3-5-10-18)25-15-21(11-12-21)16-7-6-8-17(22)13-16/h6-8,13,18H,2-5,9-12,14-15H2,1H3,(H,26,27)(H2,23,24,25) |
| InChIKey | CMFHCBXEKPDCJT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|