C20H28F3IN4O — CID 111687417
N-cyclopropyl-2-[[ethylamino-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 111687417) has the molecular formula C20H28F3IN4O and a molecular weight of 524.37 g/mol. Its IUPAC name is N-cyclopropyl-2-[[ethylamino-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-cyclopropyl-2-[[ethylamino-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111687417 |
| Molecular Formula | C20H28F3IN4O |
| Molecular Weight | 524.37 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | N-cyclopropyl-2-[[ethylamino-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC1CC1)NCC1(c2cccc(C(F)(F)F)c2)CCC1.I |
| InChI | InChI=1S/C20H27F3N4O.HI/c1-2-24-18(25-12-17(28)27-16-7-8-16)26-13-19(9-4-10-19)14-5-3-6-15(11-14)20(21,22)23;/h3,5-6,11,16H,2,4,7-10,12-13H2,1H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | NFACUGAARAIUHP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|