C17H25F3IN3O — CID 111987670
1-ethyl-3-(2-hydroxyethyl)-2-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine;hydroiodide (PubChem CID 111987670) has the molecular formula C17H25F3IN3O and a molecular weight of 471.31 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxyethyl)-2-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-hydroxyethyl)-2-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111987670 |
| Molecular Formula | C17H25F3IN3O |
| Molecular Weight | 471.31 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 1-ethyl-3-(2-hydroxyethyl)-2-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2cccc(C(F)(F)F)c2)CCC1)NCCO.I |
| InChI | InChI=1S/C17H24F3N3O.HI/c1-2-21-15(22-9-10-24)23-12-16(7-4-8-16)13-5-3-6-14(11-13)17(18,19)20;/h3,5-6,11,24H,2,4,7-10,12H2,1H3,(H2,21,22,23);1H |
| InChIKey | JMWNAWURNMAIJW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|