C20H29F3N4O2 — CID 111687416
2-[[ethylamino-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methylamino]methylidene]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 111687416) has the molecular formula C20H29F3N4O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-[[ethylamino-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methylamino]methylidene]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[ethylamino-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methylamino]methylidene]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111687416 |
| Molecular Formula | C20H29F3N4O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-[[ethylamino-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methylamino]methylidene]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)NCCOC)NCC1(c2cccc(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C20H29F3N4O2/c1-3-24-18(26-13-17(28)25-10-11-29-2)27-14-19(8-5-9-19)15-6-4-7-16(12-15)20(21,22)23/h4,6-7,12H,3,5,8-11,13-14H2,1-2H3,(H,25,28)(H2,24,26,27) |
| InChIKey | UNXMAAZFWWRTGA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|