C20H29F3N4O2 — CID 111365303
2-[[ethylamino-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111365303) has the molecular formula C20H29F3N4O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-[[ethylamino-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[ethylamino-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111365303 |
| Molecular Formula | C20H29F3N4O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-[[ethylamino-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)NCC1(c2cccc(C(F)(F)F)c2)CCOCC1 |
| InChI | InChI=1S/C20H29F3N4O2/c1-4-24-18(25-13-17(28)27(2)3)26-14-19(8-10-29-11-9-19)15-6-5-7-16(12-15)20(21,22)23/h5-7,12H,4,8-11,13-14H2,1-3H3,(H2,24,25,26) |
| InChIKey | BVHZVDGNIITSCJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|