C24H30F3IN4O — CID 111633963
3-[2-[[N-ethyl-N'-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide (PubChem CID 111633963) has the molecular formula C24H30F3IN4O and a molecular weight of 574.43 g/mol. Its IUPAC name is 3-[2-[[N-ethyl-N'-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N-ethyl-N'-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111633963 |
| Molecular Formula | C24H30F3IN4O |
| Molecular Weight | 574.43 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | 3-[2-[[N-ethyl-N'-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2cccc(C(F)(F)F)c2)CC1)NCCc1cccc(C(=O)NC)c1.I |
| InChI | InChI=1S/C24H29F3N4O.HI/c1-3-29-22(30-13-10-17-6-4-7-18(14-17)21(32)28-2)31-16-23(11-12-23)19-8-5-9-20(15-19)24(25,26)27;/h4-9,14-15H,3,10-13,16H2,1-2H3,(H,28,32)(H2,29,30,31);1H |
| InChIKey | XFZCIVNSXQUMTE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|