C26H37IN4O — CID 111668737
3-[2-[[N-ethyl-N'-[(1-phenylcyclopentyl)methyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111668737) has the molecular formula C26H37IN4O and a molecular weight of 548.51 g/mol. Its IUPAC name is 3-[2-[[N-ethyl-N'-[(1-phenylcyclopentyl)methyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N-ethyl-N'-[(1-phenylcyclopentyl)methyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111668737 |
| Molecular Formula | C26H37IN4O |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 3-[2-[[N-ethyl-N'-[(1-phenylcyclopentyl)methyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2ccccc2)CCCC1)NCCc1cccc(C(=O)N(C)C)c1.I |
| InChI | InChI=1S/C26H36N4O.HI/c1-4-27-25(28-18-15-21-11-10-12-22(19-21)24(31)30(2)3)29-20-26(16-8-9-17-26)23-13-6-5-7-14-23;/h5-7,10-14,19H,4,8-9,15-18,20H2,1-3H3,(H2,27,28,29);1H |
| InChIKey | MDYWOVYTBOZNII-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|