C19H34IN5O — CID 111632341
3-[2-[[N'-[2-(dimethylamino)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide (PubChem CID 111632341) has the molecular formula C19H34IN5O and a molecular weight of 475.42 g/mol. Its IUPAC name is 3-[2-[[N'-[2-(dimethylamino)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N'-[2-(dimethylamino)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111632341 |
| Molecular Formula | C19H34IN5O |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 3-[2-[[N'-[2-(dimethylamino)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)N(C)C)NCCc1cccc(C(=O)NC)c1.I |
| InChI | InChI=1S/C19H33N5O.HI/c1-7-21-18(23-14-19(2,3)24(5)6)22-12-11-15-9-8-10-16(13-15)17(25)20-4;/h8-10,13H,7,11-12,14H2,1-6H3,(H,20,25)(H2,21,22,23);1H |
| InChIKey | NQVHUXAOPVFWFZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|