C20H35N5O — CID 111634011
3-[2-[[N'-[2-(diethylamino)propyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111634011) has the molecular formula C20H35N5O and a molecular weight of 361.53 g/mol. Its IUPAC name is 3-[2-[[N'-[2-(diethylamino)propyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N'-[2-(diethylamino)propyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111634011 |
| Molecular Formula | C20H35N5O |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | 3-[2-[[N'-[2-(diethylamino)propyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\CC(C)N(CC)CC)NCCc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C20H35N5O/c1-6-22-20(24-15-16(4)25(7-2)8-3)23-13-12-17-10-9-11-18(14-17)19(26)21-5/h9-11,14,16H,6-8,12-13,15H2,1-5H3,(H,21,26)(H2,22,23,24) |
| InChIKey | VWPZZZQVMJEBMV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|